C31H48O10 — CID 158351128
2,2-bis(2-methylpropanoyloxymethyl)butyl 2-methylpropanoate;2-(2-phenoxyethoxy)ethyl prop-2-enoate (PubChem CID 158351128) has the molecular formula C31H48O10 and a molecular weight of 580.72 g/mol. Its IUPAC name is 2,2-bis(2-methylpropanoyloxymethyl)butyl 2-methylpropanoate;2-(2-phenoxyethoxy)ethyl prop-2-enoate.
| Compound Name | 2,2-bis(2-methylpropanoyloxymethyl)butyl 2-methylpropanoate;2-(2-phenoxyethoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 158351128 |
| Molecular Formula | C31H48O10 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 2,2-bis(2-methylpropanoyloxymethyl)butyl 2-methylpropanoate;2-(2-phenoxyethoxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOc1ccccc1.CCC(COC(=O)C(C)C)(COC(=O)C(C)C)COC(=O)C(C)C |
| InChI | InChI=1S/C18H32O6.C13H16O4/c1-8-18(9-22-15(19)12(2)3,10-23-16(20)13(4)5)11-24-17(21)14(6)7;1-2-13(14)17-11-9-15-8-10-16-12-6-4-3-5-7-12/h12-14H,8-11H2,1-7H3;2-7H,1,8-11H2 |
| InChIKey | GSIIGDRNOPGFNO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|