C45H88O20 — CID 173016029
2-[2-[2-[2-[2-[2-[2,2-bis[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 173016029) has the molecular formula C45H88O20 and a molecular weight of 949.18 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2,2-bis[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2,2-bis[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 173016029 |
| Molecular Formula | C45H88O20 |
| Molecular Weight | 949.18 g/mol |
| Exact Mass | 948.59 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2,2-bis[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxymethyl]butoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOCCOCCOCCOCCOCC(CC)(COCCOCCOCCOCCOCCOCC)COCCOCCOCCOCCOCCOCC |
| InChI | InChI=1S/C45H88O20/c1-5-44(46)65-40-39-61-32-31-57-24-23-53-19-22-56-27-30-60-35-38-64-43-45(6-2,41-62-36-33-58-28-25-54-20-17-51-15-13-49-11-9-47-7-3)42-63-37-34-59-29-26-55-21-18-52-16-14-50-12-10-48-8-4/h5H,1,6-43H2,2-4H3 |
| InChIKey | SLNYSTCRFSZGNN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 192.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|