2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid

C13H22O6 — CID 87934107

IUPAC2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.C=CC(=O)OCCOCCOCC
InChIInChI=1S/C9H16O4.C4H6O2/c1-3-9(10)13-8-7-12-6-5-11-4-2;1-3(2)4(5)6/h3H,1,4-8H2,2H3;1H2,2H3,(H,5,6)
InChIKeyMJBRODVBELHSCY-UHFFFAOYSA-N
MW274.31 g/mol
LogP1.42
Rot. Bonds9

About 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid

2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 87934107) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid.

Molecular Properties

Compound Name2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid
PubChem CID87934107
Molecular FormulaC13H22O6
Molecular Weight274.31 g/mol
Exact Mass274.14
IUPAC Name2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.C=CC(=O)OCCOCCOCC
InChIInChI=1S/C9H16O4.C4H6O2/c1-3-9(10)13-8-7-12-6-5-11-4-2;1-3(2)4(5)6/h3H,1,4-8H2,2H3;1H2,2H3,(H,5,6)
InChIKeyMJBRODVBELHSCY-UHFFFAOYSA-N
XLogP1.42
TPSA82.06 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.31
LogP ≤ 51.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid?
The IUPAC name of 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid (CID 87934107) is 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid.
What is the SMILES notation for 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid?
The canonical SMILES for 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid is C=C(C)C(=O)O.C=CC(=O)OCCOCCOCC.
What is the InChIKey of 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid?
The InChIKey is MJBRODVBELHSCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.C4H6O2/c1-3-9(10)13-8-7-12-6-5-11-4-2;1-3(2)4(5)6/h3H,1,4-8H2,2H3;1H2,2H3,(H,5,6).
What are the key properties of 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid?
2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid has a molecular weight of 274.31 g/mol, XLogP of 1.42, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyethoxy)ethyl prop-2-enoate;2-methylprop-2-enoic acid is sourced from PubChem (CID 87934107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).