C12H20O5 — CID 175424652
2-ethoxyethyl prop-2-enoate;2-methylidenebutanoic acid (PubChem CID 175424652) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-ethoxyethyl prop-2-enoate;2-methylidenebutanoic acid.
| Compound Name | 2-ethoxyethyl prop-2-enoate;2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 175424652 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-ethoxyethyl prop-2-enoate;2-methylidenebutanoic acid |
| SMILES | C=C(CC)C(=O)O.C=CC(=O)OCCOCC |
| InChI | InChI=1S/C7H12O3.C5H8O2/c1-3-7(8)10-6-5-9-4-2;1-3-4(2)5(6)7/h3H,1,4-6H2,2H3;2-3H2,1H3,(H,6,7) |
| InChIKey | IOAVEBYEJYMPFB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|