C16H28O6 — CID 175881234
2-(2-ethoxyethyl)pent-2-enoic acid;2-ethoxyethyl prop-2-enoate (PubChem CID 175881234) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)pent-2-enoic acid;2-ethoxyethyl prop-2-enoate.
| Compound Name | 2-(2-ethoxyethyl)pent-2-enoic acid;2-ethoxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 175881234 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-(2-ethoxyethyl)pent-2-enoic acid;2-ethoxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCC.CCC=C(CCOCC)C(=O)O |
| InChI | InChI=1S/C9H16O3.C7H12O3/c1-3-5-8(9(10)11)6-7-12-4-2;1-3-7(8)10-6-5-9-4-2/h5H,3-4,6-7H2,1-2H3,(H,10,11);3H,1,4-6H2,2H3 |
| InChIKey | XKEFNISQIGLRAC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|