C14H24O6 — CID 161209562
4-(2-ethoxyethoxy)-2-methylidenebutanoic acid;ethyl prop-2-enoate (PubChem CID 161209562) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-(2-ethoxyethoxy)-2-methylidenebutanoic acid;ethyl prop-2-enoate.
| Compound Name | 4-(2-ethoxyethoxy)-2-methylidenebutanoic acid;ethyl prop-2-enoate |
|---|---|
| PubChem CID | 161209562 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-(2-ethoxyethoxy)-2-methylidenebutanoic acid;ethyl prop-2-enoate |
| SMILES | C=C(CCOCCOCC)C(=O)O.C=CC(=O)OCC |
| InChI | InChI=1S/C9H16O4.C5H8O2/c1-3-12-6-7-13-5-4-8(2)9(10)11;1-3-5(6)7-4-2/h2-7H2,1H3,(H,10,11);3H,1,4H2,2H3 |
| InChIKey | UWBBLNMOZQJMLY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|