C19H34O8 — CID 87657263
5-(2-ethoxyethoxy)-2-methylidenepentanoic acid;5-(2-methoxyethoxy)-2-methylidenepentanoic acid (PubChem CID 87657263) has the molecular formula C19H34O8 and a molecular weight of 390.47 g/mol. Its IUPAC name is 5-(2-ethoxyethoxy)-2-methylidenepentanoic acid;5-(2-methoxyethoxy)-2-methylidenepentanoic acid.
| Compound Name | 5-(2-ethoxyethoxy)-2-methylidenepentanoic acid;5-(2-methoxyethoxy)-2-methylidenepentanoic acid |
|---|---|
| PubChem CID | 87657263 |
| Molecular Formula | C19H34O8 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 5-(2-ethoxyethoxy)-2-methylidenepentanoic acid;5-(2-methoxyethoxy)-2-methylidenepentanoic acid |
| SMILES | C=C(CCCOCCOC)C(=O)O.C=C(CCCOCCOCC)C(=O)O |
| InChI | InChI=1S/C10H18O4.C9H16O4/c1-3-13-7-8-14-6-4-5-9(2)10(11)12;1-8(9(10)11)4-3-5-13-7-6-12-2/h2-8H2,1H3,(H,11,12);1,3-7H2,2H3,(H,10,11) |
| InChIKey | GJZAZMFRGSWZKQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|