C28H48O11 — CID 162138519
2-butoxyethyl 2-methylprop-2-enoate;2-butoxyethyl prop-2-enoate;3-(2-ethoxyethoxycarbonyl)but-3-enoic acid (PubChem CID 162138519) has the molecular formula C28H48O11 and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-butoxyethyl 2-methylprop-2-enoate;2-butoxyethyl prop-2-enoate;3-(2-ethoxyethoxycarbonyl)but-3-enoic acid.
| Compound Name | 2-butoxyethyl 2-methylprop-2-enoate;2-butoxyethyl prop-2-enoate;3-(2-ethoxyethoxycarbonyl)but-3-enoic acid |
|---|---|
| PubChem CID | 162138519 |
| Molecular Formula | C28H48O11 |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | 2-butoxyethyl 2-methylprop-2-enoate;2-butoxyethyl prop-2-enoate;3-(2-ethoxyethoxycarbonyl)but-3-enoic acid |
| SMILES | C=C(C)C(=O)OCCOCCCC.C=C(CC(=O)O)C(=O)OCCOCC.C=CC(=O)OCCOCCCC |
| InChI | InChI=1S/C10H18O3.C9H14O5.C9H16O3/c1-4-5-6-12-7-8-13-10(11)9(2)3;1-3-13-4-5-14-9(12)7(2)6-8(10)11;1-3-5-6-11-7-8-12-9(10)4-2/h2,4-8H2,1,3H3;2-6H2,1H3,(H,10,11);4H,2-3,5-8H2,1H3 |
| InChIKey | ZJPRPSCKXZDCMZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|