C22H36O8 — CID 87986759
3-butoxycarbonylbut-3-enoic acid;butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 87986759) has the molecular formula C22H36O8 and a molecular weight of 428.52 g/mol. Its IUPAC name is 3-butoxycarbonylbut-3-enoic acid;butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
| Compound Name | 3-butoxycarbonylbut-3-enoic acid;butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87986759 |
| Molecular Formula | C22H36O8 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 3-butoxycarbonylbut-3-enoic acid;butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCCCC.C=C(CC(=O)O)C(=O)OCCCC |
| InChI | InChI=1S/C9H14O4.C8H14O2.C5H8O2/c1-3-4-5-13-9(12)7(2)6-8(10)11;1-4-5-6-10-8(9)7(2)3;1-4(2)5(6)7-3/h2-6H2,1H3,(H,10,11);2,4-6H2,1,3H3;1H2,2-3H3 |
| InChIKey | XGQYBPKXOQUWBC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|