C29H51NO9 — CID 155123449
ethyl 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]-3-(dibutylamino)propanoate (PubChem CID 155123449) has the molecular formula C29H51NO9 and a molecular weight of 557.73 g/mol. Its IUPAC name is ethyl 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]-3-(dibutylamino)propanoate.
| Compound Name | ethyl 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]-3-(dibutylamino)propanoate |
|---|---|
| PubChem CID | 155123449 |
| Molecular Formula | C29H51NO9 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.36 |
| IUPAC Name | ethyl 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]-3-(dibutylamino)propanoate |
| SMILES | C=CC(=O)OCCOCC(CC)(COCCOC(=O)C=C)COC(CN(CCCC)CCCC)C(=O)OCC |
| InChI | InChI=1S/C29H51NO9/c1-7-13-15-30(16-14-8-2)21-25(28(33)36-12-6)39-24-29(11-5,22-34-17-19-37-26(31)9-3)23-35-18-20-38-27(32)10-4/h9-10,25H,3-4,7-8,11-24H2,1-2,5-6H3 |
| InChIKey | QMBLQYROJSABHG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|