C39H62O17 — CID 158223909
2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate;2-[2-(2-hydroxyethoxymethyl)-2-(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate (PubChem CID 158223909) has the molecular formula C39H62O17 and a molecular weight of 802.91 g/mol. Its IUPAC name is 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate;2-[2-(2-hydroxyethoxymethyl)-2-(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate;2-[2-(2-hydroxyethoxymethyl)-2-(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 158223909 |
| Molecular Formula | C39H62O17 |
| Molecular Weight | 802.91 g/mol |
| Exact Mass | 802.40 |
| IUPAC Name | 2-[2,2-bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate;2-[2-(2-hydroxyethoxymethyl)-2-(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCC(CC)(COCCO)COCCOC(=O)C=C.C=CC(=O)OCCOCC(CC)(COCCOC(=O)C=C)COCCOC(=O)C=C |
| InChI | InChI=1S/C21H32O9.C18H30O8/c1-5-18(22)28-12-9-25-15-21(8-4,16-26-10-13-29-19(23)6-2)17-27-11-14-30-20(24)7-3;1-4-16(20)25-11-9-23-14-18(6-3,13-22-8-7-19)15-24-10-12-26-17(21)5-2/h5-7H,1-3,8-17H2,4H3;4-5,19H,1-2,6-15H2,3H3 |
| InChIKey | GDONUVHTRHYMPE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 207.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.91 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|