C24H30O9 — CID 87113423
4-ethoxycarbonylpenta-2,4-dienoic acid;methyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate (PubChem CID 87113423) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is 4-ethoxycarbonylpenta-2,4-dienoic acid;methyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate.
| Compound Name | 4-ethoxycarbonylpenta-2,4-dienoic acid;methyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 87113423 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 4-ethoxycarbonylpenta-2,4-dienoic acid;methyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C=CC(=O)O)C(=O)OCC.C=CC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C11H12O3.C8H10O4.C5H8O2/c1-2-11(12)14-9-8-13-10-6-4-3-5-7-10;1-3-12-8(11)6(2)4-5-7(9)10;1-4(2)5(6)7-3/h2-7H,1,8-9H2;4-5H,2-3H2,1H3,(H,9,10);1H2,2-3H3 |
| InChIKey | FWCKOGAATMBEBQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|