C20H22O6 — CID 67127109
furan-2-ylmethyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate (PubChem CID 67127109) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is furan-2-ylmethyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate.
| Compound Name | furan-2-ylmethyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 67127109 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | furan-2-ylmethyl 2-methylprop-2-enoate;2-phenoxyethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccco1.C=CC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C11H12O3.C9H10O3/c1-2-11(12)14-9-8-13-10-6-4-3-5-7-10;1-7(2)9(10)12-6-8-4-3-5-11-8/h2-7H,1,8-9H2;3-5H,1,6H2,2H3 |
| InChIKey | IAGOFOREFDFAPG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|