C15H18O6 — CID 59017570
2-[4-(2,2-dimethoxyacetyl)phenoxy]ethyl prop-2-enoate (PubChem CID 59017570) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-[4-(2,2-dimethoxyacetyl)phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-(2,2-dimethoxyacetyl)phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 59017570 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-[4-(2,2-dimethoxyacetyl)phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(C(=O)C(OC)OC)cc1 |
| InChI | InChI=1S/C15H18O6/c1-4-13(16)21-10-9-20-12-7-5-11(6-8-12)14(17)15(18-2)19-3/h4-8,15H,1,9-10H2,2-3H3 |
| InChIKey | DZQMBBLXHVRMGK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|