C22H25NO4 — CID 59642174
2-[4-[[4-(propan-2-ylcarbamoyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate (PubChem CID 59642174) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[4-[[4-(propan-2-ylcarbamoyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[[4-(propan-2-ylcarbamoyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 59642174 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-[4-[[4-(propan-2-ylcarbamoyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(Cc2ccc(C(=O)NC(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-4-21(24)27-14-13-26-20-11-7-18(8-12-20)15-17-5-9-19(10-6-17)22(25)23-16(2)3/h4-12,16H,1,13-15H2,2-3H3,(H,23,25) |
| InChIKey | CLSOZLBXZIRQRG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|