About formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate
formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate (PubChem CID 162101397) has the molecular formula C23H24O6
and a molecular weight of 396.44 g/mol. Its IUPAC name is formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate.
Molecular Properties
| Compound Name | formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate |
| PubChem CID | 162101397 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(Cc2ccc(COC(=O)C=C)cc2)cc1.C=O |
| InChI | InChI=1S/C22H22O5.CH2O/c1-3-21(23)26-14-13-25-20-11-9-18(10-12-20)15-17-5-7-19(8-6-17)16-27-22(24)4-2;1-2/h3-12H,1-2,13-16H2;1H2 |
| InChIKey | ZEXWTVBPTKZFQF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate?
The IUPAC name of formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate (CID 162101397) is formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate.
What is the SMILES notation for formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate?
The canonical SMILES for formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate is C=CC(=O)OCCOc1ccc(Cc2ccc(COC(=O)C=C)cc2)cc1.C=O.
What is the InChIKey of formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate?
The InChIKey is ZEXWTVBPTKZFQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O5.CH2O/c1-3-21(23)26-14-13-25-20-11-9-18(10-12-20)15-17-5-7-19(8-6-17)16-27-22(24)4-2;1-2/h3-12H,1-2,13-16H2;1H2.
What are the key properties of formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate?
formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate has a molecular weight of 396.44 g/mol, XLogP of 3.43, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-[4-[[4-(prop-2-enoyloxymethyl)phenyl]methyl]phenoxy]ethyl prop-2-enoate is sourced from PubChem (CID 162101397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).