About 2-pyridin-3-yloxyethyl prop-2-enoate
2-pyridin-3-yloxyethyl prop-2-enoate (PubChem CID 59502785) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-pyridin-3-yloxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-pyridin-3-yloxyethyl prop-2-enoate |
| PubChem CID | 59502785 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-pyridin-3-yloxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1cccnc1 |
| InChI | InChI=1S/C10H11NO3/c1-2-10(12)14-7-6-13-9-4-3-5-11-8-9/h2-5,8H,1,6-7H2 |
| InChIKey | LWPCVWIKXHXBIV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-3-yloxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-yloxyethyl prop-2-enoate?
The IUPAC name of 2-pyridin-3-yloxyethyl prop-2-enoate (CID 59502785) is 2-pyridin-3-yloxyethyl prop-2-enoate.
What is the SMILES notation for 2-pyridin-3-yloxyethyl prop-2-enoate?
The canonical SMILES for 2-pyridin-3-yloxyethyl prop-2-enoate is C=CC(=O)OCCOc1cccnc1.
What is the InChIKey of 2-pyridin-3-yloxyethyl prop-2-enoate?
The InChIKey is LWPCVWIKXHXBIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-2-10(12)14-7-6-13-9-4-3-5-11-8-9/h2-5,8H,1,6-7H2.
What are the key properties of 2-pyridin-3-yloxyethyl prop-2-enoate?
2-pyridin-3-yloxyethyl prop-2-enoate has a molecular weight of 193.20 g/mol, XLogP of 1.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-yloxyethyl prop-2-enoate is sourced from PubChem (CID 59502785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).