C31H25NO6 — CID 58721252
2-[4-[2-[6-[2-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethynyl]-3-pyridinyl]ethynyl]phenoxy]ethyl prop-2-enoate (PubChem CID 58721252) has the molecular formula C31H25NO6 and a molecular weight of 507.54 g/mol. Its IUPAC name is 2-[4-[2-[6-[2-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethynyl]-3-pyridinyl]ethynyl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[2-[6-[2-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethynyl]-3-pyridinyl]ethynyl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 58721252 |
| Molecular Formula | C31H25NO6 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 2-[4-[2-[6-[2-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethynyl]-3-pyridinyl]ethynyl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(C#Cc2ccc(C#Cc3ccc(OCCOC(=O)C=C)cc3)nc2)cc1 |
| InChI | InChI=1S/C31H25NO6/c1-3-30(33)37-21-19-35-28-15-9-24(10-16-28)5-6-26-8-14-27(32-23-26)13-7-25-11-17-29(18-12-25)36-20-22-38-31(34)4-2/h3-4,8-12,14-18,23H,1-2,19-22H2 |
| InChIKey | PXPHFDGAPXYBCL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|