C36H38O6 — CID 134172173
5-[4-[2-[3-methyl-4-[2-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethynyl]phenyl]ethyl]phenoxy]pentyl prop-2-enoate (PubChem CID 134172173) has the molecular formula C36H38O6 and a molecular weight of 566.69 g/mol. Its IUPAC name is 5-[4-[2-[3-methyl-4-[2-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethynyl]phenyl]ethyl]phenoxy]pentyl prop-2-enoate.
| Compound Name | 5-[4-[2-[3-methyl-4-[2-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethynyl]phenyl]ethyl]phenoxy]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 134172173 |
| Molecular Formula | C36H38O6 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 5-[4-[2-[3-methyl-4-[2-[4-(2-prop-2-enoyloxyethoxy)phenyl]ethynyl]phenyl]ethyl]phenoxy]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc(CCc2ccc(C#Cc3ccc(OCCOC(=O)C=C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C36H38O6/c1-4-35(37)41-24-8-6-7-23-39-33-19-13-29(14-20-33)9-10-31-12-18-32(28(3)27-31)17-11-30-15-21-34(22-16-30)40-25-26-42-36(38)5-2/h4-5,12-16,18-22,27H,1-2,6-10,23-26H2,3H3 |
| InChIKey | IUENAHIXZPOMMP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|