C42H46O6 — CID 59872048
7-[4-[2-[3-ethyl-4-[2-[4-(5-prop-2-enoyloxypentoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]heptyl prop-2-enoate (PubChem CID 59872048) has the molecular formula C42H46O6 and a molecular weight of 646.82 g/mol. Its IUPAC name is 7-[4-[2-[3-ethyl-4-[2-[4-(5-prop-2-enoyloxypentoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]heptyl prop-2-enoate.
| Compound Name | 7-[4-[2-[3-ethyl-4-[2-[4-(5-prop-2-enoyloxypentoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]heptyl prop-2-enoate |
|---|---|
| PubChem CID | 59872048 |
| Molecular Formula | C42H46O6 |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | 7-[4-[2-[3-ethyl-4-[2-[4-(5-prop-2-enoyloxypentoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]heptyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCOc1ccc(C#Cc2ccc(C#Cc3ccc(OCCCCCOC(=O)C=C)cc3)c(CC)c2)cc1 |
| InChI | InChI=1S/C42H46O6/c1-4-37-33-36(16-15-34-19-25-39(26-20-34)45-29-11-8-7-9-12-31-47-41(43)5-2)18-24-38(37)23-17-35-21-27-40(28-22-35)46-30-13-10-14-32-48-42(44)6-3/h5-6,18-22,24-28,33H,2-4,7-14,29-32H2,1H3 |
| InChIKey | AWJZEVJYVHILCB-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|