C31H24N2O3S — CID 58721176
6-[4-[2-[5-[2-(3,4-dicyanophenyl)ethynyl]thiophen-2-yl]ethynyl]phenoxy]hexyl prop-2-enoate (PubChem CID 58721176) has the molecular formula C31H24N2O3S and a molecular weight of 504.61 g/mol. Its IUPAC name is 6-[4-[2-[5-[2-(3,4-dicyanophenyl)ethynyl]thiophen-2-yl]ethynyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2-[5-[2-(3,4-dicyanophenyl)ethynyl]thiophen-2-yl]ethynyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 58721176 |
| Molecular Formula | C31H24N2O3S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 6-[4-[2-[5-[2-(3,4-dicyanophenyl)ethynyl]thiophen-2-yl]ethynyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C#Cc2ccc(C#Cc3ccc(C#N)c(C#N)c3)s2)cc1 |
| InChI | InChI=1S/C31H24N2O3S/c1-2-31(34)36-20-6-4-3-5-19-35-28-13-8-24(9-14-28)10-15-29-17-18-30(37-29)16-11-25-7-12-26(22-32)27(21-25)23-33/h2,7-9,12-14,17-18,21H,1,3-6,19-20H2 |
| InChIKey | NKAYFCWOGSVUGN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|