C26H21NO3S — CID 176592328
4-[6-[2-(4-isothiocyanatophenyl)ethynyl]naphthalen-2-yl]oxybutyl prop-2-enoate (PubChem CID 176592328) has the molecular formula C26H21NO3S and a molecular weight of 427.53 g/mol. Its IUPAC name is 4-[6-[2-(4-isothiocyanatophenyl)ethynyl]naphthalen-2-yl]oxybutyl prop-2-enoate.
| Compound Name | 4-[6-[2-(4-isothiocyanatophenyl)ethynyl]naphthalen-2-yl]oxybutyl prop-2-enoate |
|---|---|
| PubChem CID | 176592328 |
| Molecular Formula | C26H21NO3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 4-[6-[2-(4-isothiocyanatophenyl)ethynyl]naphthalen-2-yl]oxybutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc2cc(C#Cc3ccc(N=C=S)cc3)ccc2c1 |
| InChI | InChI=1S/C26H21NO3S/c1-2-26(28)30-16-4-3-15-29-25-14-11-22-17-21(7-10-23(22)18-25)6-5-20-8-12-24(13-9-20)27-19-31/h2,7-14,17-18H,1,3-4,15-16H2 |
| InChIKey | HDGQNTODQQSZBX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|