C35H33NO5 — CID 142724665
5-[4-[4-[6-(4-prop-2-enoyloxybutylideneamino)naphthalen-2-yl]buta-1,3-diynyl]phenoxy]pentyl prop-2-enoate (PubChem CID 142724665) has the molecular formula C35H33NO5 and a molecular weight of 547.65 g/mol. Its IUPAC name is 5-[4-[4-[6-(4-prop-2-enoyloxybutylideneamino)naphthalen-2-yl]buta-1,3-diynyl]phenoxy]pentyl prop-2-enoate.
| Compound Name | 5-[4-[4-[6-(4-prop-2-enoyloxybutylideneamino)naphthalen-2-yl]buta-1,3-diynyl]phenoxy]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 142724665 |
| Molecular Formula | C35H33NO5 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 5-[4-[4-[6-(4-prop-2-enoyloxybutylideneamino)naphthalen-2-yl]buta-1,3-diynyl]phenoxy]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC/C=N/c1ccc2cc(C#CC#Cc3ccc(OCCCCCOC(=O)C=C)cc3)ccc2c1 |
| InChI | InChI=1S/C35H33NO5/c1-3-34(37)40-24-10-5-9-23-39-33-20-15-28(16-21-33)12-6-7-13-29-14-17-31-27-32(19-18-30(31)26-29)36-22-8-11-25-41-35(38)4-2/h3-4,14-22,26-27H,1-2,5,8-11,23-25H2/b36-22+ |
| InChIKey | RKVHIGIAJFISSL-HPNXWYHWSA-N |
| XLogP | 6.73 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|