C29H31NO3 — CID 142724631
5-[4-[4-[4-(pentylideneamino)phenyl]buta-1,3-diynyl]phenoxy]pentyl prop-2-enoate (PubChem CID 142724631) has the molecular formula C29H31NO3 and a molecular weight of 441.57 g/mol. Its IUPAC name is 5-[4-[4-[4-(pentylideneamino)phenyl]buta-1,3-diynyl]phenoxy]pentyl prop-2-enoate.
| Compound Name | 5-[4-[4-[4-(pentylideneamino)phenyl]buta-1,3-diynyl]phenoxy]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 142724631 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 5-[4-[4-[4-(pentylideneamino)phenyl]buta-1,3-diynyl]phenoxy]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc(C#CC#Cc2ccc(/N=C/CCCC)cc2)cc1 |
| InChI | InChI=1S/C29H31NO3/c1-3-5-9-22-30-27-18-14-25(15-19-27)12-7-8-13-26-16-20-28(21-17-26)32-23-10-6-11-24-33-29(31)4-2/h4,14-22H,2-3,5-6,9-11,23-24H2,1H3/b30-22+ |
| InChIKey | VBHCUYCOXFPECX-JBASAIQMSA-N |
| XLogP | 6.26 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|