C29H36O5 — CID 20730901
6-[4-[2-[4-(6-hydroxyhexoxy)phenyl]ethynyl]phenoxy]hexyl prop-2-enoate (PubChem CID 20730901) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is 6-[4-[2-[4-(6-hydroxyhexoxy)phenyl]ethynyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2-[4-(6-hydroxyhexoxy)phenyl]ethynyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 20730901 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 6-[4-[2-[4-(6-hydroxyhexoxy)phenyl]ethynyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C#Cc2ccc(OCCCCCCO)cc2)cc1 |
| InChI | InChI=1S/C29H36O5/c1-2-29(31)34-24-10-6-5-9-23-33-28-19-15-26(16-20-28)12-11-25-13-17-27(18-14-25)32-22-8-4-3-7-21-30/h2,13-20,30H,1,3-10,21-24H2 |
| InChIKey | PQAIJJHWHGLWKA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|