C36H37FO6 — CID 134215117
6-[4-[2-fluoro-4-[2-[4-(4-prop-2-enoyloxybutoxy)phenyl]ethynyl]phenyl]phenoxy]hexyl prop-2-enoate (PubChem CID 134215117) has the molecular formula C36H37FO6 and a molecular weight of 584.68 g/mol. Its IUPAC name is 6-[4-[2-fluoro-4-[2-[4-(4-prop-2-enoyloxybutoxy)phenyl]ethynyl]phenyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2-fluoro-4-[2-[4-(4-prop-2-enoyloxybutoxy)phenyl]ethynyl]phenyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 134215117 |
| Molecular Formula | C36H37FO6 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 6-[4-[2-fluoro-4-[2-[4-(4-prop-2-enoyloxybutoxy)phenyl]ethynyl]phenyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(C#Cc3ccc(OCCCCOC(=O)C=C)cc3)cc2F)cc1 |
| InChI | InChI=1S/C36H37FO6/c1-3-35(38)42-25-8-6-5-7-23-40-32-20-16-30(17-21-32)33-22-15-29(27-34(33)37)12-11-28-13-18-31(19-14-28)41-24-9-10-26-43-36(39)4-2/h3-4,13-22,27H,1-2,5-10,23-26H2 |
| InChIKey | QZEKGYYUNILWLQ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|