C45H40F2O6 — CID 163946248
6-[2-fluoro-4-[4-[6-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]naphthalen-2-yl]phenyl]phenoxy]hexyl 2-fluoroprop-2-enoate (PubChem CID 163946248) has the molecular formula C45H40F2O6 and a molecular weight of 714.80 g/mol. Its IUPAC name is 6-[2-fluoro-4-[4-[6-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]naphthalen-2-yl]phenyl]phenoxy]hexyl 2-fluoroprop-2-enoate.
| Compound Name | 6-[2-fluoro-4-[4-[6-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]naphthalen-2-yl]phenyl]phenoxy]hexyl 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 163946248 |
| Molecular Formula | C45H40F2O6 |
| Molecular Weight | 714.80 g/mol |
| Exact Mass | 714.28 |
| IUPAC Name | 6-[2-fluoro-4-[4-[6-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]naphthalen-2-yl]phenyl]phenoxy]hexyl 2-fluoroprop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(C#Cc2ccc3cc(-c4ccc(-c5ccc(OCCCCCCOC(=O)C(=C)F)c(F)c5)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C45H40F2O6/c1-3-44(48)52-28-8-27-50-41-22-12-33(13-23-41)9-10-34-11-14-39-30-38(20-19-37(39)29-34)35-15-17-36(18-16-35)40-21-24-43(42(47)31-40)51-25-6-4-5-7-26-53-45(49)32(2)46/h3,11-24,29-31H,1-2,4-8,25-28H2 |
| InChIKey | RVIJRBVLUGILBI-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.80 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|