C49H44F2O5S2 — CID 167346124
5-[2-fluoro-4-[2-[4-[[6-[2-[3-fluoro-4-(5-prop-2-enoyloxypentylsulfanyl)phenyl]ethynyl]naphthalen-2-yl]methoxy]phenyl]ethynyl]phenyl]sulfanylpentyl prop-2-enoate (PubChem CID 167346124) has the molecular formula C49H44F2O5S2 and a molecular weight of 815.02 g/mol. Its IUPAC name is 5-[2-fluoro-4-[2-[4-[[6-[2-[3-fluoro-4-(5-prop-2-enoyloxypentylsulfanyl)phenyl]ethynyl]naphthalen-2-yl]methoxy]phenyl]ethynyl]phenyl]sulfanylpentyl prop-2-enoate.
| Compound Name | 5-[2-fluoro-4-[2-[4-[[6-[2-[3-fluoro-4-(5-prop-2-enoyloxypentylsulfanyl)phenyl]ethynyl]naphthalen-2-yl]methoxy]phenyl]ethynyl]phenyl]sulfanylpentyl prop-2-enoate |
|---|---|
| PubChem CID | 167346124 |
| Molecular Formula | C49H44F2O5S2 |
| Molecular Weight | 815.02 g/mol |
| Exact Mass | 814.26 |
| IUPAC Name | 5-[2-fluoro-4-[2-[4-[[6-[2-[3-fluoro-4-(5-prop-2-enoyloxypentylsulfanyl)phenyl]ethynyl]naphthalen-2-yl]methoxy]phenyl]ethynyl]phenyl]sulfanylpentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCSc1ccc(C#Cc2ccc(OCc3ccc4cc(C#Cc5ccc(SCCCCCOC(=O)C=C)c(F)c5)ccc4c3)cc2)cc1F |
| InChI | InChI=1S/C49H44F2O5S2/c1-3-48(52)54-27-7-5-9-29-57-46-25-19-38(33-44(46)50)12-11-36-17-23-43(24-18-36)56-35-40-16-22-41-31-37(15-21-42(41)32-40)13-14-39-20-26-47(45(51)34-39)58-30-10-6-8-28-55-49(53)4-2/h3-4,15-26,31-34H,1-2,5-10,27-30,35H2 |
| InChIKey | NMJKTXMMWRELCM-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.02 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|