C43H40O5S3 — CID 167346167
4-[4-[2-[4-[[4-[2-[4-(4-prop-2-enoyloxybutylsulfanyl)phenyl]ethynyl]-2-sulfanylphenoxy]methyl]phenyl]ethynyl]phenyl]sulfanylbutyl prop-2-enoate (PubChem CID 167346167) has the molecular formula C43H40O5S3 and a molecular weight of 732.99 g/mol. Its IUPAC name is 4-[4-[2-[4-[[4-[2-[4-(4-prop-2-enoyloxybutylsulfanyl)phenyl]ethynyl]-2-sulfanylphenoxy]methyl]phenyl]ethynyl]phenyl]sulfanylbutyl prop-2-enoate.
| Compound Name | 4-[4-[2-[4-[[4-[2-[4-(4-prop-2-enoyloxybutylsulfanyl)phenyl]ethynyl]-2-sulfanylphenoxy]methyl]phenyl]ethynyl]phenyl]sulfanylbutyl prop-2-enoate |
|---|---|
| PubChem CID | 167346167 |
| Molecular Formula | C43H40O5S3 |
| Molecular Weight | 732.99 g/mol |
| Exact Mass | 732.20 |
| IUPAC Name | 4-[4-[2-[4-[[4-[2-[4-(4-prop-2-enoyloxybutylsulfanyl)phenyl]ethynyl]-2-sulfanylphenoxy]methyl]phenyl]ethynyl]phenyl]sulfanylbutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCSc1ccc(C#Cc2ccc(COc3ccc(C#Cc4ccc(SCCCCOC(=O)C=C)cc4)cc3S)cc2)cc1 |
| InChI | InChI=1S/C43H40O5S3/c1-3-42(44)46-27-5-7-29-50-38-22-17-34(18-23-38)10-9-33-12-15-37(16-13-33)32-48-40-26-21-36(31-41(40)49)14-11-35-19-24-39(25-20-35)51-30-8-6-28-47-43(45)4-2/h3-4,12-13,15-26,31,49H,1-2,5-8,27-30,32H2 |
| InChIKey | DVIKGAFCJPIZQC-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.99 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|