C47H42O11 — CID 155460555
1-O-[2-[4-[2-[4-[[2-methoxycarbonyl-4-[2-[4-(2-prop-2-enoyloxyethyl)phenyl]ethynyl]phenoxy]methyl]phenyl]ethynyl]phenyl]ethyl] 4-O-(2-prop-2-enoyloxyethyl) butanedioate (PubChem CID 155460555) has the molecular formula C47H42O11 and a molecular weight of 782.84 g/mol. Its IUPAC name is 1-O-[2-[4-[2-[4-[[2-methoxycarbonyl-4-[2-[4-(2-prop-2-enoyloxyethyl)phenyl]ethynyl]phenoxy]methyl]phenyl]ethynyl]phenyl]ethyl] 4-O-(2-prop-2-enoyloxyethyl) butanedioate.
| Compound Name | 1-O-[2-[4-[2-[4-[[2-methoxycarbonyl-4-[2-[4-(2-prop-2-enoyloxyethyl)phenyl]ethynyl]phenoxy]methyl]phenyl]ethynyl]phenyl]ethyl] 4-O-(2-prop-2-enoyloxyethyl) butanedioate |
|---|---|
| PubChem CID | 155460555 |
| Molecular Formula | C47H42O11 |
| Molecular Weight | 782.84 g/mol |
| Exact Mass | 782.27 |
| IUPAC Name | 1-O-[2-[4-[2-[4-[[2-methoxycarbonyl-4-[2-[4-(2-prop-2-enoyloxyethyl)phenyl]ethynyl]phenoxy]methyl]phenyl]ethynyl]phenyl]ethyl] 4-O-(2-prop-2-enoyloxyethyl) butanedioate |
| SMILES | C=CC(=O)OCCOC(=O)CCC(=O)OCCc1ccc(C#Cc2ccc(COc3ccc(C#Cc4ccc(CCOC(=O)C=C)cc4)cc3C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C47H42O11/c1-4-43(48)54-28-26-37-14-10-35(11-15-37)16-19-39-22-23-42(41(32-39)47(52)53-3)58-33-40-20-17-36(18-21-40)7-6-34-8-12-38(13-9-34)27-29-55-45(50)24-25-46(51)57-31-30-56-44(49)5-2/h4-5,8-15,17-18,20-23,32H,1-2,24-31,33H2,3H3 |
| InChIKey | MCTJMQCDRRMKNA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.84 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|