C48H40O12 — CID 175183383
[4-(2-phenylethynyl)phenyl]methyl 2,5-bis[[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxy]benzoate (PubChem CID 175183383) has the molecular formula C48H40O12 and a molecular weight of 808.84 g/mol. Its IUPAC name is [4-(2-phenylethynyl)phenyl]methyl 2,5-bis[[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxy]benzoate.
| Compound Name | [4-(2-phenylethynyl)phenyl]methyl 2,5-bis[[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxy]benzoate |
|---|---|
| PubChem CID | 175183383 |
| Molecular Formula | C48H40O12 |
| Molecular Weight | 808.84 g/mol |
| Exact Mass | 808.25 |
| IUPAC Name | [4-(2-phenylethynyl)phenyl]methyl 2,5-bis[[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxy]benzoate |
| SMILES | C=CC(=O)OCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCOC(=O)C=C)cc3)c(C(=O)OCc3ccc(C#Cc4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C48H40O12/c1-3-44(49)56-30-8-28-54-39-22-18-37(19-23-39)46(51)59-41-26-27-43(60-47(52)38-20-24-40(25-21-38)55-29-9-31-57-45(50)4-2)42(32-41)48(53)58-33-36-16-14-35(15-17-36)13-12-34-10-6-5-7-11-34/h3-7,10-11,14-27,32H,1-2,8-9,28-31,33H2 |
| InChIKey | YPGZYZIXSFUKMQ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.84 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|