C52H60O15 — CID 54467593
8-[2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoyl]oxyoctyl furan-2-carboxylate (PubChem CID 54467593) has the molecular formula C52H60O15 and a molecular weight of 925.04 g/mol. Its IUPAC name is 8-[2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoyl]oxyoctyl furan-2-carboxylate.
| Compound Name | 8-[2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoyl]oxyoctyl furan-2-carboxylate |
|---|---|
| PubChem CID | 54467593 |
| Molecular Formula | C52H60O15 |
| Molecular Weight | 925.04 g/mol |
| Exact Mass | 924.39 |
| IUPAC Name | 8-[2,5-bis[[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy]benzoyl]oxyoctyl furan-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCOC(=O)C=C)cc3)c(C(=O)OCCCCCCCCOC(=O)c3ccco3)c2)cc1 |
| InChI | InChI=1S/C52H60O15/c1-3-47(53)62-33-15-11-9-13-31-59-41-25-21-39(22-26-41)49(55)66-43-29-30-45(67-50(56)40-23-27-42(28-24-40)60-32-14-10-12-16-34-63-48(54)4-2)44(38-43)51(57)64-35-17-7-5-6-8-18-36-65-52(58)46-20-19-37-61-46/h3-4,19-30,37-38H,1-2,5-18,31-36H2 |
| InChIKey | XGAKIWCZYFUENA-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 189.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.04 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|