C48H24O12 — CID 137458150
[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-3-[[4-[2-[4-(2-phenylethynyl)phenyl]ethynyl]phenyl]methoxycarbonyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 137458150) has the molecular formula C48H24O12 and a molecular weight of 792.71 g/mol. Its IUPAC name is [4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-3-[[4-[2-[4-(2-phenylethynyl)phenyl]ethynyl]phenyl]methoxycarbonyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-3-[[4-[2-[4-(2-phenylethynyl)phenyl]ethynyl]phenyl]methoxycarbonyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 137458150 |
| Molecular Formula | C48H24O12 |
| Molecular Weight | 792.71 g/mol |
| Exact Mass | 792.13 |
| IUPAC Name | [4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-3-[[4-[2-[4-(2-phenylethynyl)phenyl]ethynyl]phenyl]methoxycarbonyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(Oc1ccc(OC(=O)c2ccc3c(c2)C(=O)OC3=O)c(C(=O)OCc2ccc(C#Cc3ccc(C#Cc4ccccc4)cc3)cc2)c1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C48H24O12/c49-42(33-18-21-36-38(24-33)47(54)59-45(36)52)57-35-20-23-41(58-43(50)34-19-22-37-39(25-34)48(55)60-46(37)53)40(26-35)44(51)56-27-32-16-14-31(15-17-32)13-12-30-10-8-29(9-11-30)7-6-28-4-2-1-3-5-28/h1-5,8-11,14-26H,27H2 |
| InChIKey | DBPUBPWDTFOQGH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 165.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.71 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|