C25H12O9 — CID 162505278
[3-[2-(1,3-dioxo-2-benzofuran-5-yl)-2-oxoethyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 162505278) has the molecular formula C25H12O9 and a molecular weight of 456.36 g/mol. Its IUPAC name is [3-[2-(1,3-dioxo-2-benzofuran-5-yl)-2-oxoethyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [3-[2-(1,3-dioxo-2-benzofuran-5-yl)-2-oxoethyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 162505278 |
| Molecular Formula | C25H12O9 |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | [3-[2-(1,3-dioxo-2-benzofuran-5-yl)-2-oxoethyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(Cc1cccc(OC(=O)c2ccc3c(c2)C(=O)OC3=O)c1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C25H12O9/c26-20(13-4-6-16-18(10-13)24(30)33-22(16)28)9-12-2-1-3-15(8-12)32-21(27)14-5-7-17-19(11-14)25(31)34-23(17)29/h1-8,10-11H,9H2 |
| InChIKey | VHKXPFRYHRSJOQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|