C35H18O11 — CID 102479836
[4-[(1E,4E)-5-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyphenyl]-3-oxopenta-1,4-dienyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 102479836) has the molecular formula C35H18O11 and a molecular weight of 614.52 g/mol. Its IUPAC name is [4-[(1E,4E)-5-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyphenyl]-3-oxopenta-1,4-dienyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-[(1E,4E)-5-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyphenyl]-3-oxopenta-1,4-dienyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 102479836 |
| Molecular Formula | C35H18O11 |
| Molecular Weight | 614.52 g/mol |
| Exact Mass | 614.08 |
| IUPAC Name | [4-[(1E,4E)-5-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyphenyl]-3-oxopenta-1,4-dienyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(/C=C/c1ccc(OC(=O)c2ccc3c(c2)C(=O)OC3=O)cc1)/C=C/c1ccc(OC(=O)c2ccc3c(c2)C(=O)OC3=O)cc1 |
| InChI | InChI=1S/C35H18O11/c36-23(9-1-19-3-11-24(12-4-19)43-30(37)21-7-15-26-28(17-21)34(41)45-32(26)39)10-2-20-5-13-25(14-6-20)44-31(38)22-8-16-27-29(18-22)35(42)46-33(27)40/h1-18H/b9-1+,10-2+ |
| InChIKey | CMCOSTVAOVZFMV-UVEKSMONSA-N |
| XLogP | 5.04 |
| TPSA | 156.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|