C24H18O5 — CID 142022090
[4-[1-(4-hydroxyphenyl)ethyl]phenyl] 1-methylidene-3-oxo-2-benzofuran-5-carboxylate (PubChem CID 142022090) has the molecular formula C24H18O5 and a molecular weight of 386.40 g/mol. Its IUPAC name is [4-[1-(4-hydroxyphenyl)ethyl]phenyl] 1-methylidene-3-oxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-[1-(4-hydroxyphenyl)ethyl]phenyl] 1-methylidene-3-oxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 142022090 |
| Molecular Formula | C24H18O5 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | [4-[1-(4-hydroxyphenyl)ethyl]phenyl] 1-methylidene-3-oxo-2-benzofuran-5-carboxylate |
| SMILES | C=C1OC(=O)c2cc(C(=O)Oc3ccc(C(C)c4ccc(O)cc4)cc3)ccc21 |
| InChI | InChI=1S/C24H18O5/c1-14(16-3-8-19(25)9-4-16)17-5-10-20(11-6-17)29-23(26)18-7-12-21-15(2)28-24(27)22(21)13-18/h3-14,25H,2H2,1H3 |
| InChIKey | YYLDWQBHGTXIFA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|