C21H12O9 — CID 146653316
2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyethyl 3-methylidene-1-oxo-2-benzofuran-5-carboxylate (PubChem CID 146653316) has the molecular formula C21H12O9 and a molecular weight of 408.32 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyethyl 3-methylidene-1-oxo-2-benzofuran-5-carboxylate.
| Compound Name | 2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyethyl 3-methylidene-1-oxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 146653316 |
| Molecular Formula | C21H12O9 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyethyl 3-methylidene-1-oxo-2-benzofuran-5-carboxylate |
| SMILES | C=C1OC(=O)c2ccc(C(=O)OCCOC(=O)c3ccc4c(c3)C(=O)OC4=O)cc21 |
| InChI | InChI=1S/C21H12O9/c1-10-15-8-11(2-4-13(15)19(24)29-10)17(22)27-6-7-28-18(23)12-3-5-14-16(9-12)21(26)30-20(14)25/h2-5,8-9H,1,6-7H2 |
| InChIKey | WZLYXHUQONADCK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|