C20H16O6 — CID 171439229
2-[(4-ethenylphenyl)methoxy]ethyl 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 171439229) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is 2-[(4-ethenylphenyl)methoxy]ethyl 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | 2-[(4-ethenylphenyl)methoxy]ethyl 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 171439229 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[(4-ethenylphenyl)methoxy]ethyl 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | C=Cc1ccc(COCCOC(=O)c2ccc3c(c2)C(=O)OC3=O)cc1 |
| InChI | InChI=1S/C20H16O6/c1-2-13-3-5-14(6-4-13)12-24-9-10-25-18(21)15-7-8-16-17(11-15)20(23)26-19(16)22/h2-8,11H,1,9-10,12H2 |
| InChIKey | VBDPZKJUBUIMOZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|