C15H14O7 — CID 59221267
6-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyhexanoic acid (PubChem CID 59221267) has the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. Its IUPAC name is 6-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyhexanoic acid.
| Compound Name | 6-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyhexanoic acid |
|---|---|
| PubChem CID | 59221267 |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 6-(1,3-dioxo-2-benzofuran-5-carbonyl)oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOC(=O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C15H14O7/c16-12(17)4-2-1-3-7-21-13(18)9-5-6-10-11(8-9)15(20)22-14(10)19/h5-6,8H,1-4,7H2,(H,16,17) |
| InChIKey | DIAIFZQDDWEEHL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|