C24H16O10 — CID 144631712
[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxycyclohexyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 144631712) has the molecular formula C24H16O10 and a molecular weight of 464.38 g/mol. Its IUPAC name is [4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxycyclohexyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxycyclohexyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 144631712 |
| Molecular Formula | C24H16O10 |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | [4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxycyclohexyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(OC1CCC(OC(=O)c2ccc3c(c2)C(=O)OC3=O)CC1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C24H16O10/c25-19(11-1-7-15-17(9-11)23(29)33-21(15)27)31-13-3-5-14(6-4-13)32-20(26)12-2-8-16-18(10-12)24(30)34-22(16)28/h1-2,7-10,13-14H,3-6H2 |
| InChIKey | WJXHNFGMGOXZGP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|