C20H10O9 — CID 118545018
(1,3-dioxo-2-benzofuran-5-carbonyl)oxymethyl 1-methylidene-3-oxo-2-benzofuran-5-carboxylate (PubChem CID 118545018) has the molecular formula C20H10O9 and a molecular weight of 394.29 g/mol. Its IUPAC name is (1,3-dioxo-2-benzofuran-5-carbonyl)oxymethyl 1-methylidene-3-oxo-2-benzofuran-5-carboxylate.
| Compound Name | (1,3-dioxo-2-benzofuran-5-carbonyl)oxymethyl 1-methylidene-3-oxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 118545018 |
| Molecular Formula | C20H10O9 |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | (1,3-dioxo-2-benzofuran-5-carbonyl)oxymethyl 1-methylidene-3-oxo-2-benzofuran-5-carboxylate |
| SMILES | C=C1OC(=O)c2cc(C(=O)OCOC(=O)c3ccc4c(c3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C20H10O9/c1-9-12-4-2-10(6-14(12)19(24)28-9)16(21)26-8-27-17(22)11-3-5-13-15(7-11)20(25)29-18(13)23/h2-7H,1,8H2 |
| InChIKey | UFPWCBUIDAWODH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|