C10H5KO4 — CID 142056050
potassium 3-methylidene-1-oxo-2-benzofuran-5-carboxylate (PubChem CID 142056050) has the molecular formula C10H5KO4 and a molecular weight of 228.24 g/mol. Its IUPAC name is potassium 3-methylidene-1-oxo-2-benzofuran-5-carboxylate.
| Compound Name | potassium 3-methylidene-1-oxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 142056050 |
| Molecular Formula | C10H5KO4 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | potassium 3-methylidene-1-oxo-2-benzofuran-5-carboxylate |
| SMILES | C=C1OC(=O)c2ccc(C(=O)[O-])cc21.[K+] |
| InChI | InChI=1S/C10H6O4.K/c1-5-8-4-6(9(11)12)2-3-7(8)10(13)14-5;/h2-4H,1H2,(H,11,12);/q;+1/p-1 |
| InChIKey | JTTKYRPPFKSBTM-UHFFFAOYSA-M |
| XLogP | -2.80 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |