C26H14N2O9 — CID 161125101
3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-[(1-methylidene-3-oxo-2-benzofuran-5-carbonyl)amino]benzoic acid (PubChem CID 161125101) has the molecular formula C26H14N2O9 and a molecular weight of 498.40 g/mol. Its IUPAC name is 3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-[(1-methylidene-3-oxo-2-benzofuran-5-carbonyl)amino]benzoic acid.
| Compound Name | 3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-[(1-methylidene-3-oxo-2-benzofuran-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 161125101 |
| Molecular Formula | C26H14N2O9 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-5-[(1-methylidene-3-oxo-2-benzofuran-5-carbonyl)amino]benzoic acid |
| SMILES | C=C1OC(=O)c2cc(C(=O)Nc3cc(NC(=O)c4ccc5c(c4)C(=O)OC5=O)cc(C(=O)O)c3)ccc21 |
| InChI | InChI=1S/C26H14N2O9/c1-11-17-4-2-12(8-19(17)25(34)36-11)21(29)27-15-6-14(23(31)32)7-16(10-15)28-22(30)13-3-5-18-20(9-13)26(35)37-24(18)33/h2-10H,1H2,(H,27,29)(H,28,30)(H,31,32) |
| InChIKey | ULLOKROLXVINPM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|