C18H9ClO10 — CID 87560099
benzene-1,3,5-tricarboxylic acid;1,3-dioxo-2-benzofuran-5-carbonyl chloride (PubChem CID 87560099) has the molecular formula C18H9ClO10 and a molecular weight of 420.71 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;1,3-dioxo-2-benzofuran-5-carbonyl chloride.
| Compound Name | benzene-1,3,5-tricarboxylic acid;1,3-dioxo-2-benzofuran-5-carbonyl chloride |
|---|---|
| PubChem CID | 87560099 |
| Molecular Formula | C18H9ClO10 |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;1,3-dioxo-2-benzofuran-5-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2c(c1)C(=O)OC2=O.O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H3ClO4.C9H6O6/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H;1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | DSRVYUGGHRWPEH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 172.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|