4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid

C21H12O7 — CID 142735073

IUPAC4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid
SMILESO=C(O)c1ccc(Oc2cccc(Oc3ccc4c(c3)C(=O)OC4=O)c2)cc1
InChIInChI=1S/C21H12O7/c22-19(23)12-4-6-13(7-5-12)26-14-2-1-3-15(10-14)27-16-8-9-17-18(11-16)21(25)28-20(17)24/h1-11H,(H,22,23)
InChIKeyQRRDSIAHDSLEII-UHFFFAOYSA-N
MW376.32 g/mol
LogP4.28
Rot. Bonds5

About 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid

4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid (PubChem CID 142735073) has the molecular formula C21H12O7 and a molecular weight of 376.32 g/mol. Its IUPAC name is 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid.

Molecular Properties

Compound Name4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid
PubChem CID142735073
Molecular FormulaC21H12O7
Molecular Weight376.32 g/mol
Exact Mass376.06
IUPAC Name4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid
SMILESO=C(O)c1ccc(Oc2cccc(Oc3ccc4c(c3)C(=O)OC4=O)c2)cc1
InChIInChI=1S/C21H12O7/c22-19(23)12-4-6-13(7-5-12)26-14-2-1-3-15(10-14)27-16-8-9-17-18(11-16)21(25)28-20(17)24/h1-11H,(H,22,23)
InChIKeyQRRDSIAHDSLEII-UHFFFAOYSA-N
XLogP4.28
TPSA99.13 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500376.32
LogP ≤ 54.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid?
The IUPAC name of 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid (CID 142735073) is 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid.
What is the SMILES notation for 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid?
The canonical SMILES for 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid is O=C(O)c1ccc(Oc2cccc(Oc3ccc4c(c3)C(=O)OC4=O)c2)cc1.
What is the InChIKey of 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid?
The InChIKey is QRRDSIAHDSLEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12O7/c22-19(23)12-4-6-13(7-5-12)26-14-2-1-3-15(10-14)27-16-8-9-17-18(11-16)21(25)28-20(17)24/h1-11H,(H,22,23).
What are the key properties of 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid?
4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid has a molecular weight of 376.32 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenoxy]benzoic acid is sourced from PubChem (CID 142735073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).