C16H10O7 — CID 145140801
5-[(1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl)oxy]-2-benzofuran-1,3-dione (PubChem CID 145140801) has the molecular formula C16H10O7 and a molecular weight of 314.25 g/mol. Its IUPAC name is 5-[(1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl)oxy]-2-benzofuran-1,3-dione.
| Compound Name | 5-[(1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl)oxy]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 145140801 |
| Molecular Formula | C16H10O7 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 5-[(1,3-dihydroxy-1,3-dihydro-2-benzofuran-5-yl)oxy]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(Oc3ccc4c(c3)C(O)OC4O)ccc21 |
| InChI | InChI=1S/C16H10O7/c17-13-9-3-1-7(5-11(9)15(19)22-13)21-8-2-4-10-12(6-8)16(20)23-14(10)18/h1-6,13,15,17,19H |
| InChIKey | MPFRCUXNTZGZQN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|