C17H8O7 — CID 123238658
5-(4-hydroxy-1-oxoisochromen-6-yl)oxy-2-benzofuran-1,3-dione (PubChem CID 123238658) has the molecular formula C17H8O7 and a molecular weight of 324.24 g/mol. Its IUPAC name is 5-(4-hydroxy-1-oxoisochromen-6-yl)oxy-2-benzofuran-1,3-dione.
| Compound Name | 5-(4-hydroxy-1-oxoisochromen-6-yl)oxy-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 123238658 |
| Molecular Formula | C17H8O7 |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 5-(4-hydroxy-1-oxoisochromen-6-yl)oxy-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(Oc3ccc4c(=O)occ(O)c4c3)ccc21 |
| InChI | InChI=1S/C17H8O7/c18-14-7-22-15(19)10-3-1-8(5-12(10)14)23-9-2-4-11-13(6-9)17(21)24-16(11)20/h1-7,18H |
| InChIKey | QWLPROSTRWQYSV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|