C28H30O5 — CID 157494991
2-tert-butylphenol;5-(2-tert-butylphenoxy)-2-benzofuran-1,3-dione (PubChem CID 157494991) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-tert-butylphenol;5-(2-tert-butylphenoxy)-2-benzofuran-1,3-dione.
| Compound Name | 2-tert-butylphenol;5-(2-tert-butylphenoxy)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 157494991 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-tert-butylphenol;5-(2-tert-butylphenoxy)-2-benzofuran-1,3-dione |
| SMILES | CC(C)(C)c1ccccc1O.CC(C)(C)c1ccccc1Oc1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C18H16O4.C10H14O/c1-18(2,3)14-6-4-5-7-15(14)21-11-8-9-12-13(10-11)17(20)22-16(12)19;1-10(2,3)8-6-4-5-7-9(8)11/h4-10H,1-3H3;4-7,11H,1-3H3 |
| InChIKey | BXSJGUYFJNGHKP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|