C24H20O4 — CID 20688254
5-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]-2-benzofuran-1,3-dione (PubChem CID 20688254) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is 5-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 20688254 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]-2-benzofuran-1,3-dione |
| SMILES | Cc1ccc(C(C)(C)c2ccc(Oc3ccc4c(c3)C(=O)OC4=O)cc2)cc1 |
| InChI | InChI=1S/C24H20O4/c1-15-4-6-16(7-5-15)24(2,3)17-8-10-18(11-9-17)27-19-12-13-20-21(14-19)23(26)28-22(20)25/h4-14H,1-3H3 |
| InChIKey | NFVSYPHJFDNYEZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|