C36H19F3O8 — CID 102003983
5-[4-[1-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-2,2,2-trifluoro-1-phenylethyl]phenoxy]-2-benzofuran-1,3-dione (PubChem CID 102003983) has the molecular formula C36H19F3O8 and a molecular weight of 636.53 g/mol. Its IUPAC name is 5-[4-[1-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-2,2,2-trifluoro-1-phenylethyl]phenoxy]-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-[1-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-2,2,2-trifluoro-1-phenylethyl]phenoxy]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 102003983 |
| Molecular Formula | C36H19F3O8 |
| Molecular Weight | 636.53 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | 5-[4-[1-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-2,2,2-trifluoro-1-phenylethyl]phenoxy]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(Oc3ccc(C(c4ccccc4)(c4ccc(Oc5ccc6c(c5)C(=O)OC6=O)cc4)C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C36H19F3O8/c37-36(38,39)35(20-4-2-1-3-5-20,21-6-10-23(11-7-21)44-25-14-16-27-29(18-25)33(42)46-31(27)40)22-8-12-24(13-9-22)45-26-15-17-28-30(19-26)34(43)47-32(28)41/h1-19H |
| InChIKey | QQFQSVODMIKCQM-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.53 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|